C23H31N3O6S — CID 173263746
acetic acid;[3-[(1-methanehydrazonoylpiperidin-4-yl)methoxy]-5-methylphenyl] 3-methylbenzenesulfonate (PubChem CID 173263746) has the molecular formula C23H31N3O6S and a molecular weight of 477.58 g/mol. Its IUPAC name is acetic acid;[3-[(1-methanehydrazonoylpiperidin-4-yl)methoxy]-5-methylphenyl] 3-methylbenzenesulfonate.
| Compound Name | acetic acid;[3-[(1-methanehydrazonoylpiperidin-4-yl)methoxy]-5-methylphenyl] 3-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173263746 |
| Molecular Formula | C23H31N3O6S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | acetic acid;[3-[(1-methanehydrazonoylpiperidin-4-yl)methoxy]-5-methylphenyl] 3-methylbenzenesulfonate |
| SMILES | CC(=O)O.Cc1cc(OCC2CCN(C=NN)CC2)cc(OS(=O)(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C21H27N3O4S.C2H4O2/c1-16-4-3-5-21(12-16)29(25,26)28-20-11-17(2)10-19(13-20)27-14-18-6-8-24(9-7-18)15-23-22;1-2(3)4/h3-5,10-13,15,18H,6-9,14,22H2,1-2H3;1H3,(H,3,4) |
| InChIKey | YRZVXAACSIWKNF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|