C25H28N4O5 — CID 70094962
1,3,7-tris(prop-2-enyl)-8-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]purine-2,6-dione (PubChem CID 70094962) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1,3,7-tris(prop-2-enyl)-8-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]purine-2,6-dione.
| Compound Name | 1,3,7-tris(prop-2-enyl)-8-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]purine-2,6-dione |
|---|---|
| PubChem CID | 70094962 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1,3,7-tris(prop-2-enyl)-8-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]purine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(nc(/C=C/c3cc(OC)c(OC)c(OC)c3)n2CC=C)n(CC=C)c1=O |
| InChI | InChI=1S/C25H28N4O5/c1-7-12-27-20(11-10-17-15-18(32-4)22(34-6)19(16-17)33-5)26-23-21(27)24(30)29(14-9-3)25(31)28(23)13-8-2/h7-11,15-16H,1-3,12-14H2,4-6H3/b11-10+ |
| InChIKey | KTLITCDPVSEEFG-ZHACJKMWSA-N |
| XLogP | 3.11 |
| TPSA | 89.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|