C30H23N5O4S — CID 70096084
N-[4-[[[2-(2-phenylmethoxyphenyl)-1,3-thiazole-4-carbonyl]amino]carbamoyl]phenyl]pyridine-4-carboxamide (PubChem CID 70096084) has the molecular formula C30H23N5O4S and a molecular weight of 549.61 g/mol. Its IUPAC name is N-[4-[[[2-(2-phenylmethoxyphenyl)-1,3-thiazole-4-carbonyl]amino]carbamoyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[4-[[[2-(2-phenylmethoxyphenyl)-1,3-thiazole-4-carbonyl]amino]carbamoyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 70096084 |
| Molecular Formula | C30H23N5O4S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | N-[4-[[[2-(2-phenylmethoxyphenyl)-1,3-thiazole-4-carbonyl]amino]carbamoyl]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(NNC(=O)c1csc(-c2ccccc2OCc2ccccc2)n1)c1ccc(NC(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C30H23N5O4S/c36-27(22-14-16-31-17-15-22)32-23-12-10-21(11-13-23)28(37)34-35-29(38)25-19-40-30(33-25)24-8-4-5-9-26(24)39-18-20-6-2-1-3-7-20/h1-17,19H,18H2,(H,32,36)(H,34,37)(H,35,38) |
| InChIKey | KFLBOJXVICGIIA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|