C32H24N4O2S — CID 70113139
2-(2-phenylmethoxyphenyl)-N'-(6-phenylquinolin-2-yl)-1,3-thiazole-4-carbohydrazide (PubChem CID 70113139) has the molecular formula C32H24N4O2S and a molecular weight of 528.64 g/mol. Its IUPAC name is 2-(2-phenylmethoxyphenyl)-N'-(6-phenylquinolin-2-yl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-(2-phenylmethoxyphenyl)-N'-(6-phenylquinolin-2-yl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 70113139 |
| Molecular Formula | C32H24N4O2S |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2-(2-phenylmethoxyphenyl)-N'-(6-phenylquinolin-2-yl)-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(NNc1ccc2cc(-c3ccccc3)ccc2n1)c1csc(-c2ccccc2OCc2ccccc2)n1 |
| InChI | InChI=1S/C32H24N4O2S/c37-31(36-35-30-18-16-25-19-24(15-17-27(25)33-30)23-11-5-2-6-12-23)28-21-39-32(34-28)26-13-7-8-14-29(26)38-20-22-9-3-1-4-10-22/h1-19,21H,20H2,(H,33,35)(H,36,37) |
| InChIKey | CEAQCFWUKKZOSE-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|