C31H23N7O3 — CID 130197452
N'-[6-[3-hydroxy-4-[(quinolin-2-ylamino)carbamoyl]phenyl]quinolin-2-yl]pyridine-2-carbohydrazide (PubChem CID 130197452) has the molecular formula C31H23N7O3 and a molecular weight of 541.57 g/mol. Its IUPAC name is N'-[6-[3-hydroxy-4-[(quinolin-2-ylamino)carbamoyl]phenyl]quinolin-2-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[6-[3-hydroxy-4-[(quinolin-2-ylamino)carbamoyl]phenyl]quinolin-2-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 130197452 |
| Molecular Formula | C31H23N7O3 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | N'-[6-[3-hydroxy-4-[(quinolin-2-ylamino)carbamoyl]phenyl]quinolin-2-yl]pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1ccc2cc(-c3ccc(C(=O)NNc4ccc5ccccc5n4)c(O)c3)ccc2n1)c1ccccn1 |
| InChI | InChI=1S/C31H23N7O3/c39-27-18-21(8-12-23(27)30(40)37-35-28-14-10-19-5-1-2-6-24(19)33-28)20-9-13-25-22(17-20)11-15-29(34-25)36-38-31(41)26-7-3-4-16-32-26/h1-18,39H,(H,33,35)(H,34,36)(H,37,40)(H,38,41) |
| InChIKey | QUJADCJYIQBCDN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|