C28H24N4O3S — CID 70113516
N'-[3-(methoxymethyl)quinolin-2-yl]-2-(2-phenylmethoxyphenyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 70113516) has the molecular formula C28H24N4O3S and a molecular weight of 496.59 g/mol. Its IUPAC name is N'-[3-(methoxymethyl)quinolin-2-yl]-2-(2-phenylmethoxyphenyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[3-(methoxymethyl)quinolin-2-yl]-2-(2-phenylmethoxyphenyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 70113516 |
| Molecular Formula | C28H24N4O3S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | N'-[3-(methoxymethyl)quinolin-2-yl]-2-(2-phenylmethoxyphenyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | COCc1cc2ccccc2nc1NNC(=O)c1csc(-c2ccccc2OCc2ccccc2)n1 |
| InChI | InChI=1S/C28H24N4O3S/c1-34-17-21-15-20-11-5-7-13-23(20)29-26(21)31-32-27(33)24-18-36-28(30-24)22-12-6-8-14-25(22)35-16-19-9-3-2-4-10-19/h2-15,18H,16-17H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | PZCHHQXIMVDKJJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|