C22H33N3O8S — CID 70097581
hydroxylamine;1-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylic acid (PubChem CID 70097581) has the molecular formula C22H33N3O8S and a molecular weight of 499.59 g/mol. Its IUPAC name is hydroxylamine;1-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylic acid.
| Compound Name | hydroxylamine;1-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70097581 |
| Molecular Formula | C22H33N3O8S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | hydroxylamine;1-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylic acid |
| SMILES | COc1ccc(CCN2CCC(C(=O)O)CC2S(=O)(=O)c2ccc(OC)cc2)cc1.NO.NO |
| InChI | InChI=1S/C22H27NO6S.2H3NO/c1-28-18-5-3-16(4-6-18)11-13-23-14-12-17(22(24)25)15-21(23)30(26,27)20-9-7-19(29-2)8-10-20;2*1-2/h3-10,17,21H,11-15H2,1-2H3,(H,24,25);2*2H,1H2 |
| InChIKey | RYMFAGLCYSQQEX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 185.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|