C25H26N2O5S — CID 70126130
4-(4-methoxyphenyl)sulfonyl-1-[(4-pyridin-2-ylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 70126130) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-1-[(4-pyridin-2-ylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-1-[(4-pyridin-2-ylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70126130 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-1-[(4-pyridin-2-ylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(Cc3ccc(-c4ccccn4)cc3)C(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C25H26N2O5S/c1-32-20-9-11-21(12-10-20)33(30,31)22-13-15-27(24(16-22)25(28)29)17-18-5-7-19(8-6-18)23-4-2-3-14-26-23/h2-12,14,22,24H,13,15-17H2,1H3,(H,28,29) |
| InChIKey | KKERFNLSLPUQAO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |