C25H33NO6S — CID 54511086
4-(4-butoxyphenyl)sulfonyl-1-(3-phenoxypropyl)piperidine-2-carboxylic acid (PubChem CID 54511086) has the molecular formula C25H33NO6S and a molecular weight of 475.61 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)sulfonyl-1-(3-phenoxypropyl)piperidine-2-carboxylic acid.
| Compound Name | 4-(4-butoxyphenyl)sulfonyl-1-(3-phenoxypropyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54511086 |
| Molecular Formula | C25H33NO6S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-(4-butoxyphenyl)sulfonyl-1-(3-phenoxypropyl)piperidine-2-carboxylic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)C2CCN(CCCOc3ccccc3)C(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C25H33NO6S/c1-2-3-17-31-21-10-12-22(13-11-21)33(29,30)23-14-16-26(24(19-23)25(27)28)15-7-18-32-20-8-5-4-6-9-20/h4-6,8-13,23-24H,2-3,7,14-19H2,1H3,(H,27,28) |
| InChIKey | YJDZLZVILDPHJB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|