C31H37NO6S — CID 70114638
ethyl 4-(4-butoxyphenyl)sulfonyl-1-[(3-phenoxyphenyl)methyl]piperidine-2-carboxylate (PubChem CID 70114638) has the molecular formula C31H37NO6S and a molecular weight of 551.71 g/mol. Its IUPAC name is ethyl 4-(4-butoxyphenyl)sulfonyl-1-[(3-phenoxyphenyl)methyl]piperidine-2-carboxylate.
| Compound Name | ethyl 4-(4-butoxyphenyl)sulfonyl-1-[(3-phenoxyphenyl)methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 70114638 |
| Molecular Formula | C31H37NO6S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | ethyl 4-(4-butoxyphenyl)sulfonyl-1-[(3-phenoxyphenyl)methyl]piperidine-2-carboxylate |
| SMILES | CCCCOc1ccc(S(=O)(=O)C2CCN(Cc3cccc(Oc4ccccc4)c3)C(C(=O)OCC)C2)cc1 |
| InChI | InChI=1S/C31H37NO6S/c1-3-5-20-37-25-14-16-28(17-15-25)39(34,35)29-18-19-32(30(22-29)31(33)36-4-2)23-24-10-9-13-27(21-24)38-26-11-7-6-8-12-26/h6-17,21,29-30H,3-5,18-20,22-23H2,1-2H3 |
| InChIKey | FQICHERCCKIEBO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|