C26H35NO6S — CID 70114463
ethyl 4-(4-butoxyphenyl)sulfonyl-1-(2-phenoxyethyl)piperidine-2-carboxylate (PubChem CID 70114463) has the molecular formula C26H35NO6S and a molecular weight of 489.63 g/mol. Its IUPAC name is ethyl 4-(4-butoxyphenyl)sulfonyl-1-(2-phenoxyethyl)piperidine-2-carboxylate.
| Compound Name | ethyl 4-(4-butoxyphenyl)sulfonyl-1-(2-phenoxyethyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 70114463 |
| Molecular Formula | C26H35NO6S |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | ethyl 4-(4-butoxyphenyl)sulfonyl-1-(2-phenoxyethyl)piperidine-2-carboxylate |
| SMILES | CCCCOc1ccc(S(=O)(=O)C2CCN(CCOc3ccccc3)C(C(=O)OCC)C2)cc1 |
| InChI | InChI=1S/C26H35NO6S/c1-3-5-18-32-22-11-13-23(14-12-22)34(29,30)24-15-16-27(25(20-24)26(28)31-4-2)17-19-33-21-9-7-6-8-10-21/h6-14,24-25H,3-5,15-20H2,1-2H3 |
| InChIKey | ZHPSAPFHVKEGQA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|