C23H31IN2O6S — CID 70132928
4-(4-butoxyphenyl)sulfonyl-2-[iodo(phenyl)methyl]piperidine-1-carboxylic acid;hydroxylamine (PubChem CID 70132928) has the molecular formula C23H31IN2O6S and a molecular weight of 590.48 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)sulfonyl-2-[iodo(phenyl)methyl]piperidine-1-carboxylic acid;hydroxylamine.
| Compound Name | 4-(4-butoxyphenyl)sulfonyl-2-[iodo(phenyl)methyl]piperidine-1-carboxylic acid;hydroxylamine |
|---|---|
| PubChem CID | 70132928 |
| Molecular Formula | C23H31IN2O6S |
| Molecular Weight | 590.48 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | 4-(4-butoxyphenyl)sulfonyl-2-[iodo(phenyl)methyl]piperidine-1-carboxylic acid;hydroxylamine |
| SMILES | CCCCOc1ccc(S(=O)(=O)C2CCN(C(=O)O)C(C(I)c3ccccc3)C2)cc1.NO |
| InChI | InChI=1S/C23H28INO5S.H3NO/c1-2-3-15-30-18-9-11-19(12-10-18)31(28,29)20-13-14-25(23(26)27)21(16-20)22(24)17-7-5-4-6-8-17;1-2/h4-12,20-22H,2-3,13-16H2,1H3,(H,26,27);2H,1H2 |
| InChIKey | OYSKANINQFWRCR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|