C23H39Cl2FN2O — CID 70097667
4-[2-(4-fluorophenoxy)ethyl]-1-(1-piperidin-3-ylpentyl)piperidine;dihydrochloride (PubChem CID 70097667) has the molecular formula C23H39Cl2FN2O and a molecular weight of 449.48 g/mol. Its IUPAC name is 4-[2-(4-fluorophenoxy)ethyl]-1-(1-piperidin-3-ylpentyl)piperidine;dihydrochloride.
| Compound Name | 4-[2-(4-fluorophenoxy)ethyl]-1-(1-piperidin-3-ylpentyl)piperidine;dihydrochloride |
|---|---|
| PubChem CID | 70097667 |
| Molecular Formula | C23H39Cl2FN2O |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 4-[2-(4-fluorophenoxy)ethyl]-1-(1-piperidin-3-ylpentyl)piperidine;dihydrochloride |
| SMILES | CCCCC(C1CCCNC1)N1CCC(CCOc2ccc(F)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C23H37FN2O.2ClH/c1-2-3-6-23(20-5-4-14-25-18-20)26-15-11-19(12-16-26)13-17-27-22-9-7-21(24)8-10-22;;/h7-10,19-20,23,25H,2-6,11-18H2,1H3;2*1H |
| InChIKey | UQKZPVIRLIBVSK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |