C13H16NO4- — CID 7010089
(2R)-2-benzamido-2-(hydroxymethyl)-3-methylbutanoate (PubChem CID 7010089) has the molecular formula C13H16NO4- and a molecular weight of 250.27 g/mol. Its IUPAC name is (2R)-2-benzamido-2-(hydroxymethyl)-3-methylbutanoate.
| Compound Name | (2R)-2-benzamido-2-(hydroxymethyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7010089 |
| Molecular Formula | C13H16NO4- |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2R)-2-benzamido-2-(hydroxymethyl)-3-methylbutanoate |
| SMILES | CC(C)[C@](CO)(NC(=O)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C13H17NO4/c1-9(2)13(8-15,12(17)18)14-11(16)10-6-4-3-5-7-10/h3-7,9,15H,8H2,1-2H3,(H,14,16)(H,17,18)/p-1/t13-/m0/s1 |
| InChIKey | LNEDAIGVCSVPDM-ZDUSSCGKSA-M |
| XLogP | -0.45 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |