C14H18NO4- — CID 7167590
(2S)-2-benzamido-2-(hydroxymethyl)-4-methylpentanoate (PubChem CID 7167590) has the molecular formula C14H18NO4- and a molecular weight of 264.30 g/mol. Its IUPAC name is (2S)-2-benzamido-2-(hydroxymethyl)-4-methylpentanoate.
| Compound Name | (2S)-2-benzamido-2-(hydroxymethyl)-4-methylpentanoate |
|---|---|
| PubChem CID | 7167590 |
| Molecular Formula | C14H18NO4- |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2S)-2-benzamido-2-(hydroxymethyl)-4-methylpentanoate |
| SMILES | CC(C)C[C@@](CO)(NC(=O)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C14H19NO4/c1-10(2)8-14(9-16,13(18)19)15-12(17)11-6-4-3-5-7-11/h3-7,10,16H,8-9H2,1-2H3,(H,15,17)(H,18,19)/p-1/t14-/m0/s1 |
| InChIKey | FKUCELLBHQAFFX-AWEZNQCLSA-M |
| XLogP | -0.06 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |