C30H32ClN3O4 — CID 70103367
N-[1-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]-9,10-dioxoanthracene-2-carboxamide;hydrochloride (PubChem CID 70103367) has the molecular formula C30H32ClN3O4 and a molecular weight of 534.06 g/mol. Its IUPAC name is N-[1-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]-9,10-dioxoanthracene-2-carboxamide;hydrochloride.
| Compound Name | N-[1-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]-9,10-dioxoanthracene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70103367 |
| Molecular Formula | C30H32ClN3O4 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | N-[1-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]-9,10-dioxoanthracene-2-carboxamide;hydrochloride |
| SMILES | CCCC(NC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O)N1CCN(c2cccc(OC)c2)CC1.Cl |
| InChI | InChI=1S/C30H31N3O4.ClH/c1-3-7-27(33-16-14-32(15-17-33)21-8-6-9-22(19-21)37-2)31-30(36)20-12-13-25-26(18-20)29(35)24-11-5-4-10-23(24)28(25)34;/h4-6,8-13,18-19,27H,3,7,14-17H2,1-2H3,(H,31,36);1H |
| InChIKey | JLDKUBHKHXXOTE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|