C24H28N4O3 — CID 70104966
4-[(E)-3-(4-cyanophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]benzonitrile;1,1-dimethoxy-N,N-dimethylmethanamine (PubChem CID 70104966) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[(E)-3-(4-cyanophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]benzonitrile;1,1-dimethoxy-N,N-dimethylmethanamine.
| Compound Name | 4-[(E)-3-(4-cyanophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]benzonitrile;1,1-dimethoxy-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 70104966 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 4-[(E)-3-(4-cyanophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]benzonitrile;1,1-dimethoxy-N,N-dimethylmethanamine |
| SMILES | CN(C)/C=C(/C(=O)c1ccc(C#N)cc1)c1ccc(C#N)cc1.COC(OC)N(C)C |
| InChI | InChI=1S/C19H15N3O.C5H13NO2/c1-22(2)13-18(16-7-3-14(11-20)4-8-16)19(23)17-9-5-15(12-21)6-10-17;1-6(2)5(7-3)8-4/h3-10,13H,1-2H3;5H,1-4H3/b18-13+; |
| InChIKey | VPICPUOFVJWTMS-PUBYZPQMSA-N |
| XLogP | 3.34 |
| TPSA | 89.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|