C28H36Cl3N5O5 — CID 70107185
ethyl 2-[(2R)-2-[(2S)-2-[2-[1-ethyl-6-[(trichloromethoxycarbonylhydrazinylidene)methyl]indol-2-yl]ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]acetate (PubChem CID 70107185) has the molecular formula C28H36Cl3N5O5 and a molecular weight of 628.99 g/mol. Its IUPAC name is ethyl 2-[(2R)-2-[(2S)-2-[2-[1-ethyl-6-[(trichloromethoxycarbonylhydrazinylidene)methyl]indol-2-yl]ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]acetate.
| Compound Name | ethyl 2-[(2R)-2-[(2S)-2-[2-[1-ethyl-6-[(trichloromethoxycarbonylhydrazinylidene)methyl]indol-2-yl]ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 70107185 |
| Molecular Formula | C28H36Cl3N5O5 |
| Molecular Weight | 628.99 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | ethyl 2-[(2R)-2-[(2S)-2-[2-[1-ethyl-6-[(trichloromethoxycarbonylhydrazinylidene)methyl]indol-2-yl]ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC[C@@H]1C(=O)N1CCC[C@H]1CCc1cc2ccc(C=NNC(=O)OC(Cl)(Cl)Cl)cc2n1CC |
| InChI | InChI=1S/C28H36Cl3N5O5/c1-3-35-22(16-20-10-9-19(15-24(20)35)17-32-33-27(39)41-28(29,30)31)12-11-21-7-5-14-36(21)26(38)23-8-6-13-34(23)18-25(37)40-4-2/h9-10,15-17,21,23H,3-8,11-14,18H2,1-2H3,(H,33,39)/t21-,23+/m0/s1 |
| InChIKey | NFSSAVKVOJEVRA-JTHBVZDNSA-N |
| XLogP | 5.00 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.99 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|