C23H22ClN3OS — CID 70113518
4-[2-[4-chloro-3-(5-thiophen-3-yl-3-pyridinyl)-1H-indol-2-yl]ethyl]morpholine (PubChem CID 70113518) has the molecular formula C23H22ClN3OS and a molecular weight of 423.97 g/mol. Its IUPAC name is 4-[2-[4-chloro-3-(5-thiophen-3-yl-3-pyridinyl)-1H-indol-2-yl]ethyl]morpholine.
| Compound Name | 4-[2-[4-chloro-3-(5-thiophen-3-yl-3-pyridinyl)-1H-indol-2-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 70113518 |
| Molecular Formula | C23H22ClN3OS |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-[2-[4-chloro-3-(5-thiophen-3-yl-3-pyridinyl)-1H-indol-2-yl]ethyl]morpholine |
| SMILES | Clc1cccc2[nH]c(CCN3CCOCC3)c(-c3cncc(-c4ccsc4)c3)c12 |
| InChI | InChI=1S/C23H22ClN3OS/c24-19-2-1-3-20-23(19)22(21(26-20)4-6-27-7-9-28-10-8-27)18-12-17(13-25-14-18)16-5-11-29-15-16/h1-3,5,11-15,26H,4,6-10H2 |
| InChIKey | LYIQLMHZGJNYBJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |