C22H30ClN5O — CID 123258041
N'-[1-[8-chloro-1-(2-morpholin-4-ylethyl)isoquinolin-3-yl]ethyl]-N-methyl-N-(methylideneamino)propanimidamide (PubChem CID 123258041) has the molecular formula C22H30ClN5O and a molecular weight of 415.97 g/mol. Its IUPAC name is N'-[1-[8-chloro-1-(2-morpholin-4-ylethyl)isoquinolin-3-yl]ethyl]-N-methyl-N-(methylideneamino)propanimidamide.
| Compound Name | N'-[1-[8-chloro-1-(2-morpholin-4-ylethyl)isoquinolin-3-yl]ethyl]-N-methyl-N-(methylideneamino)propanimidamide |
|---|---|
| PubChem CID | 123258041 |
| Molecular Formula | C22H30ClN5O |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N'-[1-[8-chloro-1-(2-morpholin-4-ylethyl)isoquinolin-3-yl]ethyl]-N-methyl-N-(methylideneamino)propanimidamide |
| SMILES | C=NN(C)/C(CC)=N/C(C)c1cc2cccc(Cl)c2c(CCN2CCOCC2)n1 |
| InChI | InChI=1S/C22H30ClN5O/c1-5-21(27(4)24-3)25-16(2)20-15-17-7-6-8-18(23)22(17)19(26-20)9-10-28-11-13-29-14-12-28/h6-8,15-16H,3,5,9-14H2,1-2,4H3/b25-21+ |
| InChIKey | NCPLNXZPWSGNQB-NJNXFGOHSA-N |
| XLogP | 4.18 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|