About 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine
2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine (PubChem CID 70115817) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine.
Molecular Properties
| Compound Name | 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine |
| PubChem CID | 70115817 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine |
| SMILES | CC(C(=O)O)N1CCCC1=O.Nc1cccnc1 |
| InChI | InChI=1S/C7H11NO3.C5H6N2/c1-5(7(10)11)8-4-2-3-6(8)9;6-5-2-1-3-7-4-5/h5H,2-4H2,1H3,(H,10,11);1-4H,6H2 |
| InChIKey | VSCNCPAFAYOGFW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine?
The IUPAC name of 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine (CID 70115817) is 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine.
What is the SMILES notation for 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine?
The canonical SMILES for 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine is CC(C(=O)O)N1CCCC1=O.Nc1cccnc1.
What is the InChIKey of 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine?
The InChIKey is VSCNCPAFAYOGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3.C5H6N2/c1-5(7(10)11)8-4-2-3-6(8)9;6-5-2-1-3-7-4-5/h5H,2-4H2,1H3,(H,10,11);1-4H,6H2.
What are the key properties of 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine?
2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine has a molecular weight of 251.29 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxopyrrolidin-1-yl)propanoic acid;pyridin-3-amine is sourced from PubChem (CID 70115817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).