C16H24ClNO2Si — CID 70116156
CID 70116156 (PubChem CID 70116156) has the molecular formula C16H24ClNO2Si and a molecular weight of 325.91 g/mol.
| Compound Name | CID 70116156 |
|---|---|
| PubChem CID | 70116156 |
| Molecular Formula | C16H24ClNO2Si |
| Molecular Weight | 325.91 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | — |
| SMILES | Cc1c(CO[Si]C(C)(C)C(C)C)cccc1NC(=O)CCl |
| InChI | InChI=1S/C16H24ClNO2Si/c1-11(2)16(4,5)21-20-10-13-7-6-8-14(12(13)3)18-15(19)9-17/h6-8,11H,9-10H2,1-5H3,(H,18,19) |
| InChIKey | QHTMPJIDMSOJCY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.91 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|