C26H20N2O5S2 — CID 70117424
2-[[4-benzylsulfanyl-2-(4-nitrophenyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-6-yl]oxy]acetic acid (PubChem CID 70117424) has the molecular formula C26H20N2O5S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-[[4-benzylsulfanyl-2-(4-nitrophenyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-6-yl]oxy]acetic acid.
| Compound Name | 2-[[4-benzylsulfanyl-2-(4-nitrophenyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-6-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 70117424 |
| Molecular Formula | C26H20N2O5S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-[[4-benzylsulfanyl-2-(4-nitrophenyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-6-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CC(SCc1ccccc1)c1sc(-c3ccc([N+](=O)[O-])cc3)nc1-2 |
| InChI | InChI=1S/C26H20N2O5S2/c29-23(30)14-33-21-8-4-7-19-20(21)13-22(34-15-16-5-2-1-3-6-16)25-24(19)27-26(35-25)17-9-11-18(12-10-17)28(31)32/h1-12,22H,13-15H2,(H,29,30) |
| InChIKey | VXCRXEXZAYWZIO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|