C23H29FN2O3 — CID 70117894
1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-3-methyl-2-piperazin-1-ylbutan-1-one (PubChem CID 70117894) has the molecular formula C23H29FN2O3 and a molecular weight of 400.49 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-3-methyl-2-piperazin-1-ylbutan-1-one.
| Compound Name | 1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-3-methyl-2-piperazin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 70117894 |
| Molecular Formula | C23H29FN2O3 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-3-methyl-2-piperazin-1-ylbutan-1-one |
| SMILES | COc1cc(C(=O)C(C(C)C)N2CCNCC2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H29FN2O3/c1-16(2)22(26-12-10-25-11-13-26)23(27)18-6-9-20(21(14-18)28-3)29-15-17-4-7-19(24)8-5-17/h4-9,14,16,22,25H,10-13,15H2,1-3H3 |
| InChIKey | DJBLITXDKMATNR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |