C21H25NO7 — CID 70119660
1-O-benzyl 3-O-(2-methoxyethyl) 5-amino-4-(2-methoxyethoxy)benzene-1,3-dicarboxylate (PubChem CID 70119660) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is 1-O-benzyl 3-O-(2-methoxyethyl) 5-amino-4-(2-methoxyethoxy)benzene-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-(2-methoxyethyl) 5-amino-4-(2-methoxyethoxy)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70119660 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-O-benzyl 3-O-(2-methoxyethyl) 5-amino-4-(2-methoxyethoxy)benzene-1,3-dicarboxylate |
| SMILES | COCCOC(=O)c1cc(C(=O)OCc2ccccc2)cc(N)c1OCCOC |
| InChI | InChI=1S/C21H25NO7/c1-25-8-10-27-19-17(21(24)28-11-9-26-2)12-16(13-18(19)22)20(23)29-14-15-6-4-3-5-7-15/h3-7,12-13H,8-11,14,22H2,1-2H3 |
| InChIKey | YYONOCHXXOUWPJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|