C22H22O5 — CID 123966288
3-O-benzyl 1-O-methyl 4-prop-2-enoxy-5-prop-2-enylbenzene-1,3-dicarboxylate (PubChem CID 123966288) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is 3-O-benzyl 1-O-methyl 4-prop-2-enoxy-5-prop-2-enylbenzene-1,3-dicarboxylate.
| Compound Name | 3-O-benzyl 1-O-methyl 4-prop-2-enoxy-5-prop-2-enylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 123966288 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 3-O-benzyl 1-O-methyl 4-prop-2-enoxy-5-prop-2-enylbenzene-1,3-dicarboxylate |
| SMILES | C=CCOc1c(CC=C)cc(C(=O)OC)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22O5/c1-4-9-17-13-18(21(23)25-3)14-19(20(17)26-12-5-2)22(24)27-15-16-10-7-6-8-11-16/h4-8,10-11,13-14H,1-2,9,12,15H2,3H3 |
| InChIKey | JOMZPSDHQGZFRE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|