C21H20O6 — CID 123598367
3-O-benzyl 1-O-methyl 4-acetyloxy-5-prop-2-enylbenzene-1,3-dicarboxylate (PubChem CID 123598367) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-O-benzyl 1-O-methyl 4-acetyloxy-5-prop-2-enylbenzene-1,3-dicarboxylate.
| Compound Name | 3-O-benzyl 1-O-methyl 4-acetyloxy-5-prop-2-enylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 123598367 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-O-benzyl 1-O-methyl 4-acetyloxy-5-prop-2-enylbenzene-1,3-dicarboxylate |
| SMILES | C=CCc1cc(C(=O)OC)cc(C(=O)OCc2ccccc2)c1OC(C)=O |
| InChI | InChI=1S/C21H20O6/c1-4-8-16-11-17(20(23)25-3)12-18(19(16)27-14(2)22)21(24)26-13-15-9-6-5-7-10-15/h4-7,9-12H,1,8,13H2,2-3H3 |
| InChIKey | MKZQWLWUHKMBOT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|