C16H19ClN2OS2 — CID 70125318
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-chloro-5-thiophen-2-yl-3H-thiophene-2-carboxamide (PubChem CID 70125318) has the molecular formula C16H19ClN2OS2 and a molecular weight of 354.93 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-chloro-5-thiophen-2-yl-3H-thiophene-2-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-chloro-5-thiophen-2-yl-3H-thiophene-2-carboxamide |
|---|---|
| PubChem CID | 70125318 |
| Molecular Formula | C16H19ClN2OS2 |
| Molecular Weight | 354.93 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-chloro-5-thiophen-2-yl-3H-thiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)C1(Cl)CC=C(c2cccs2)S1 |
| InChI | InChI=1S/C16H19ClN2OS2/c17-16(6-3-14(22-16)13-2-1-9-21-13)15(20)18-12-10-19-7-4-11(12)5-8-19/h1-3,9,11-12H,4-8,10H2,(H,18,20)/t12-,16?/m0/s1 |
| InChIKey | BXBOQNXEHYHIAO-HKALDPMFSA-N |
| XLogP | 3.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.93 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|