C36H36N8O2 — CID 70131082
N-[(E)-4,5-diamino-8-[(9-methylphenazine-1-carbonyl)amino]oct-4-enyl]-9-methylphenazine-1-carboxamide (PubChem CID 70131082) has the molecular formula C36H36N8O2 and a molecular weight of 612.74 g/mol. Its IUPAC name is N-[(E)-4,5-diamino-8-[(9-methylphenazine-1-carbonyl)amino]oct-4-enyl]-9-methylphenazine-1-carboxamide.
| Compound Name | N-[(E)-4,5-diamino-8-[(9-methylphenazine-1-carbonyl)amino]oct-4-enyl]-9-methylphenazine-1-carboxamide |
|---|---|
| PubChem CID | 70131082 |
| Molecular Formula | C36H36N8O2 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | N-[(E)-4,5-diamino-8-[(9-methylphenazine-1-carbonyl)amino]oct-4-enyl]-9-methylphenazine-1-carboxamide |
| SMILES | Cc1cccc2nc3cccc(C(=O)NCCC/C(N)=C(\N)CCCNC(=O)c4cccc5nc6cccc(C)c6nc45)c3nc12 |
| InChI | InChI=1S/C36H36N8O2/c1-21-9-3-15-27-31(21)43-33-23(11-5-17-29(33)41-27)35(45)39-19-7-13-25(37)26(38)14-8-20-40-36(46)24-12-6-18-30-34(24)44-32-22(2)10-4-16-28(32)42-30/h3-6,9-12,15-18H,7-8,13-14,19-20,37-38H2,1-2H3,(H,39,45)(H,40,46)/b26-25+ |
| InChIKey | VMICCPVRMXGZCO-OCEACIFDSA-N |
| XLogP | 5.35 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|