C37H41N9O — CID 163495440
N-[2-[3-[2-[[amino-(9-methylphenazin-1-yl)methylidene]amino]ethyl-methylamino]propyl-methylamino]ethyl]-9-methylphenazine-1-carboxamide (PubChem CID 163495440) has the molecular formula C37H41N9O and a molecular weight of 627.80 g/mol. Its IUPAC name is N-[2-[3-[2-[[amino-(9-methylphenazin-1-yl)methylidene]amino]ethyl-methylamino]propyl-methylamino]ethyl]-9-methylphenazine-1-carboxamide.
| Compound Name | N-[2-[3-[2-[[amino-(9-methylphenazin-1-yl)methylidene]amino]ethyl-methylamino]propyl-methylamino]ethyl]-9-methylphenazine-1-carboxamide |
|---|---|
| PubChem CID | 163495440 |
| Molecular Formula | C37H41N9O |
| Molecular Weight | 627.80 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | N-[2-[3-[2-[[amino-(9-methylphenazin-1-yl)methylidene]amino]ethyl-methylamino]propyl-methylamino]ethyl]-9-methylphenazine-1-carboxamide |
| SMILES | Cc1cccc2nc3cccc(C(=O)NCCN(C)CCCN(C)CC/N=C(\N)c4cccc5nc6cccc(C)c6nc45)c3nc12 |
| InChI | InChI=1S/C37H41N9O/c1-24-10-5-14-28-32(24)43-34-26(12-7-16-30(34)41-28)36(38)39-18-22-45(3)20-9-21-46(4)23-19-40-37(47)27-13-8-17-31-35(27)44-33-25(2)11-6-15-29(33)42-31/h5-8,10-17H,9,18-23H2,1-4H3,(H2,38,39)(H,40,47) |
| InChIKey | CQHGUDFDCLJSQV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.80 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|