C34H32Cl2N8O2 — CID 10699482
6-chloro-N-[2-[2-[2-[(6-chloro-9-methylphenazine-1-carbonyl)amino]ethylamino]ethylamino]ethyl]-9-methylphenazine-1-carboxamide (PubChem CID 10699482) has the molecular formula C34H32Cl2N8O2 and a molecular weight of 655.59 g/mol. Its IUPAC name is 6-chloro-N-[2-[2-[2-[(6-chloro-9-methylphenazine-1-carbonyl)amino]ethylamino]ethylamino]ethyl]-9-methylphenazine-1-carboxamide.
| Compound Name | 6-chloro-N-[2-[2-[2-[(6-chloro-9-methylphenazine-1-carbonyl)amino]ethylamino]ethylamino]ethyl]-9-methylphenazine-1-carboxamide |
|---|---|
| PubChem CID | 10699482 |
| Molecular Formula | C34H32Cl2N8O2 |
| Molecular Weight | 655.59 g/mol |
| Exact Mass | 654.20 |
| IUPAC Name | 6-chloro-N-[2-[2-[2-[(6-chloro-9-methylphenazine-1-carbonyl)amino]ethylamino]ethylamino]ethyl]-9-methylphenazine-1-carboxamide |
| SMILES | Cc1ccc(Cl)c2nc3cccc(C(=O)NCCNCCNCCNC(=O)c4cccc5nc6c(Cl)ccc(C)c6nc45)c3nc12 |
| InChI | InChI=1S/C34H32Cl2N8O2/c1-19-9-11-23(35)31-27(19)43-29-21(5-3-7-25(29)41-31)33(45)39-17-15-37-13-14-38-16-18-40-34(46)22-6-4-8-26-30(22)44-28-20(2)10-12-24(36)32(28)42-26/h3-12,37-38H,13-18H2,1-2H3,(H,39,45)(H,40,46) |
| InChIKey | SUGMRYLGIQPWTI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|