C32H39Cl2F3N3O11P — CID 70134826
2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide;2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene;2-(phosphonomethylamino)acetic acid (PubChem CID 70134826) has the molecular formula C32H39Cl2F3N3O11P and a molecular weight of 800.55 g/mol. Its IUPAC name is 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide;2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene;2-(phosphonomethylamino)acetic acid.
| Compound Name | 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide;2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene;2-(phosphonomethylamino)acetic acid |
|---|---|
| PubChem CID | 70134826 |
| Molecular Formula | C32H39Cl2F3N3O11P |
| Molecular Weight | 800.55 g/mol |
| Exact Mass | 799.17 |
| IUPAC Name | 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide;2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene;2-(phosphonomethylamino)acetic acid |
| SMILES | CCOCN(C(=O)CCl)c1c(C)cccc1CC.CCOc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].O=C(O)CNCP(=O)(O)O |
| InChI | InChI=1S/C15H11ClF3NO4.C14H20ClNO2.C3H8NO5P/c1-2-23-14-8-10(4-5-12(14)20(21)22)24-13-6-3-9(7-11(13)16)15(17,18)19;1-4-12-8-6-7-11(3)14(12)16(10-18-5-2)13(17)9-15;5-3(6)1-4-2-10(7,8)9/h3-8H,2H2,1H3;6-8H,4-5,9-10H2,1-3H3;4H,1-2H2,(H,5,6)(H2,7,8,9) |
| InChIKey | KXKWDLCJSAJVMP-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 198.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.55 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|