C28H27Cl2F3N2O7 — CID 70134605
2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide;5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid (PubChem CID 70134605) has the molecular formula C28H27Cl2F3N2O7 and a molecular weight of 631.43 g/mol. Its IUPAC name is 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide;5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid.
| Compound Name | 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide;5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 70134605 |
| Molecular Formula | C28H27Cl2F3N2O7 |
| Molecular Weight | 631.43 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide;5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid |
| SMILES | CCOCN(C(=O)CCl)c1c(C)cccc1CC.O=C(O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7ClF3NO5.C14H20ClNO2/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)13(20)21;1-4-12-8-6-7-11(3)14(12)16(10-18-5-2)13(17)9-15/h1-6H,(H,20,21);6-8H,4-5,9-10H2,1-3H3 |
| InChIKey | XIWVCZSALMEHNE-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.43 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|