C32H39Cl3N3O12P — CID 70135490
2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate;2-(phosphonomethylamino)acetic acid (PubChem CID 70135490) has the molecular formula C32H39Cl3N3O12P and a molecular weight of 795.01 g/mol. Its IUPAC name is 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate;2-(phosphonomethylamino)acetic acid.
| Compound Name | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate;2-(phosphonomethylamino)acetic acid |
|---|---|
| PubChem CID | 70135490 |
| Molecular Formula | C32H39Cl3N3O12P |
| Molecular Weight | 795.01 g/mol |
| Exact Mass | 793.13 |
| IUPAC Name | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate;2-(phosphonomethylamino)acetic acid |
| SMILES | CCc1cccc(C)c1N(C(=O)CCl)C(C)COC.COC(=O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-].O=C(O)CNCP(=O)(O)O |
| InChI | InChI=1S/C15H22ClNO2.C14H9Cl2NO5.C3H8NO5P/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4;1-21-14(18)10-7-9(3-4-12(10)17(19)20)22-13-5-2-8(15)6-11(13)16;5-3(6)1-4-2-10(7,8)9/h6-8,12H,5,9-10H2,1-4H3;2-7H,1H3;4H,1-2H2,(H,5,6)(H2,7,8,9) |
| InChIKey | YCORYCLULZMVRC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 215.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.01 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|