C30H39Cl2N4O10P — CID 70135851
2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;2-chloro-6-nitro-3-phenoxyaniline;2-(phosphonomethylamino)acetic acid (PubChem CID 70135851) has the molecular formula C30H39Cl2N4O10P and a molecular weight of 717.54 g/mol. Its IUPAC name is 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;2-chloro-6-nitro-3-phenoxyaniline;2-(phosphonomethylamino)acetic acid.
| Compound Name | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;2-chloro-6-nitro-3-phenoxyaniline;2-(phosphonomethylamino)acetic acid |
|---|---|
| PubChem CID | 70135851 |
| Molecular Formula | C30H39Cl2N4O10P |
| Molecular Weight | 717.54 g/mol |
| Exact Mass | 716.18 |
| IUPAC Name | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;2-chloro-6-nitro-3-phenoxyaniline;2-(phosphonomethylamino)acetic acid |
| SMILES | CCc1cccc(C)c1N(C(=O)CCl)C(C)COC.Nc1c([N+](=O)[O-])ccc(Oc2ccccc2)c1Cl.O=C(O)CNCP(=O)(O)O |
| InChI | InChI=1S/C15H22ClNO2.C12H9ClN2O3.C3H8NO5P/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4;13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17;5-3(6)1-4-2-10(7,8)9/h6-8,12H,5,9-10H2,1-4H3;1-7H,14H2;4H,1-2H2,(H,5,6)(H2,7,8,9) |
| InChIKey | CKTPYEYCQIWPDN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 214.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|