C32H43Cl2N4O9P — CID 70135575
2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;2-chloro-6-nitro-3-phenoxyaniline (PubChem CID 70135575) has the molecular formula C32H43Cl2N4O9P and a molecular weight of 729.60 g/mol. Its IUPAC name is 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;2-chloro-6-nitro-3-phenoxyaniline.
| Compound Name | 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;2-chloro-6-nitro-3-phenoxyaniline |
|---|---|
| PubChem CID | 70135575 |
| Molecular Formula | C32H43Cl2N4O9P |
| Molecular Weight | 729.60 g/mol |
| Exact Mass | 728.21 |
| IUPAC Name | 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide;2-chloro-6-nitro-3-phenoxyaniline |
| SMILES | CCc1cccc(C)c1N(C(=O)CCl)C(C)COC.CP(=O)(O)CCC(N)C(=O)O.Nc1c([N+](=O)[O-])ccc(Oc2ccccc2)c1Cl |
| InChI | InChI=1S/C15H22ClNO2.C12H9ClN2O3.C5H12NO4P/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4;13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17;1-11(9,10)3-2-4(6)5(7)8/h6-8,12H,5,9-10H2,1-4H3;1-7H,14H2;4H,2-3,6H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | GOUOGGBZFGYQJE-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 208.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|