C28H33N3O6Si — CID 70134864
(19-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl) 2-amino-2-[butyl(dimethyl)silyl]acetate (PubChem CID 70134864) has the molecular formula C28H33N3O6Si and a molecular weight of 535.67 g/mol. Its IUPAC name is (19-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl) 2-amino-2-[butyl(dimethyl)silyl]acetate.
| Compound Name | (19-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl) 2-amino-2-[butyl(dimethyl)silyl]acetate |
|---|---|
| PubChem CID | 70134864 |
| Molecular Formula | C28H33N3O6Si |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | (19-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-yl) 2-amino-2-[butyl(dimethyl)silyl]acetate |
| SMILES | CCCC[Si](C)(C)C(N)C(=O)OC1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(O)ccc3nc2-1 |
| InChI | InChI=1S/C28H33N3O6Si/c1-5-7-10-38(3,4)24(29)26(34)37-28(6-2)20-13-22-23-17(11-16-12-18(32)8-9-21(16)30-23)14-31(22)25(33)19(20)15-36-27(28)35/h8-9,11-13,24,32H,5-7,10,14-15,29H2,1-4H3 |
| InChIKey | NTNDCIIGRTWKEE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|