C24H35Cl2N7O3S — CID 70135097
5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;4-N-ethyl-6-methylsulfanyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 70135097) has the molecular formula C24H35Cl2N7O3S and a molecular weight of 572.56 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;4-N-ethyl-6-methylsulfanyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;4-N-ethyl-6-methylsulfanyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 70135097 |
| Molecular Formula | C24H35Cl2N7O3S |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;4-N-ethyl-6-methylsulfanyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)Oc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl.CCNc1nc(NC(C)C)nc(SC)n1 |
| InChI | InChI=1S/C15H18Cl2N2O3.C9H17N5S/c1-8(2)21-12-7-11(9(16)6-10(12)17)19-14(20)22-13(18-19)15(3,4)5;1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4/h6-8H,1-5H3;6H,5H2,1-4H3,(H2,10,11,12,13,14) |
| InChIKey | GHKAPKFGTAUCJB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |