C26H29N3O5 — CID 70136717
tert-butyl N-[3-[1-(9,10-dioxoanthracen-1-yl)piperazin-2-yl]-3-oxopropyl]carbamate (PubChem CID 70136717) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(9,10-dioxoanthracen-1-yl)piperazin-2-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(9,10-dioxoanthracen-1-yl)piperazin-2-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 70136717 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | tert-butyl N-[3-[1-(9,10-dioxoanthracen-1-yl)piperazin-2-yl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)C1CNCCN1c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H29N3O5/c1-26(2,3)34-25(33)28-12-11-21(30)20-15-27-13-14-29(20)19-10-6-9-18-22(19)24(32)17-8-5-4-7-16(17)23(18)31/h4-10,20,27H,11-15H2,1-3H3,(H,28,33) |
| InChIKey | CLBWZNRPEPOFGY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|