C13H9N5O6S — CID 70137908
furan-2-carboxylic acid;N-(5-nitro-2-pyridinyl)thiadiazole-4-carboxamide (PubChem CID 70137908) has the molecular formula C13H9N5O6S and a molecular weight of 363.31 g/mol. Its IUPAC name is furan-2-carboxylic acid;N-(5-nitro-2-pyridinyl)thiadiazole-4-carboxamide.
| Compound Name | furan-2-carboxylic acid;N-(5-nitro-2-pyridinyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 70137908 |
| Molecular Formula | C13H9N5O6S |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | furan-2-carboxylic acid;N-(5-nitro-2-pyridinyl)thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cn1)c1csnn1.O=C(O)c1ccco1 |
| InChI | InChI=1S/C8H5N5O3S.C5H4O3/c14-8(6-4-17-12-11-6)10-7-2-1-5(3-9-7)13(15)16;6-5(7)4-2-1-3-8-4/h1-4H,(H,9,10,14);1-3H,(H,6,7) |
| InChIKey | KVCIBSWDHJVXTD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 161.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|