C28H37Cl2N5O — CID 70138314
1-N-(1-benzylpiperidin-4-yl)-2-chlorobenzene-1,4-diamine;2-chloro-1-N-(2-methoxyethyl)-1-N-methylbenzene-1,4-diamine (PubChem CID 70138314) has the molecular formula C28H37Cl2N5O and a molecular weight of 530.54 g/mol. Its IUPAC name is 1-N-(1-benzylpiperidin-4-yl)-2-chlorobenzene-1,4-diamine;2-chloro-1-N-(2-methoxyethyl)-1-N-methylbenzene-1,4-diamine.
| Compound Name | 1-N-(1-benzylpiperidin-4-yl)-2-chlorobenzene-1,4-diamine;2-chloro-1-N-(2-methoxyethyl)-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 70138314 |
| Molecular Formula | C28H37Cl2N5O |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 1-N-(1-benzylpiperidin-4-yl)-2-chlorobenzene-1,4-diamine;2-chloro-1-N-(2-methoxyethyl)-1-N-methylbenzene-1,4-diamine |
| SMILES | COCCN(C)c1ccc(N)cc1Cl.Nc1ccc(NC2CCN(Cc3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H22ClN3.C10H15ClN2O/c19-17-12-15(20)6-7-18(17)21-16-8-10-22(11-9-16)13-14-4-2-1-3-5-14;1-13(5-6-14-2)10-4-3-8(12)7-9(10)11/h1-7,12,16,21H,8-11,13,20H2;3-4,7H,5-6,12H2,1-2H3 |
| InChIKey | ULZIINDHGVZXSH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|