C37H30F3N3O2 — CID 70142839
N-[3-[[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methylcarbamoyl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 70142839) has the molecular formula C37H30F3N3O2 and a molecular weight of 605.66 g/mol. Its IUPAC name is N-[3-[[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methylcarbamoyl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[3-[[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methylcarbamoyl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 70142839 |
| Molecular Formula | C37H30F3N3O2 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | N-[3-[[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methylcarbamoyl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(NCc1ccc(N2CCc3ccccc3C2)cc1)c1cccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C37H30F3N3O2/c38-37(39,40)30-16-14-27(15-17-30)33-10-3-4-11-34(33)36(45)42-31-9-5-8-28(22-31)35(44)41-23-25-12-18-32(19-13-25)43-21-20-26-6-1-2-7-29(26)24-43/h1-19,22H,20-21,23-24H2,(H,41,44)(H,42,45) |
| InChIKey | YUIPNARXYAGKPH-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|