About [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate
[1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate (PubChem CID 70145187) has the molecular formula C18H21O5P
and a molecular weight of 348.34 g/mol. Its IUPAC name is [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate |
| PubChem CID | 70145187 |
| Molecular Formula | C18H21O5P |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CP(O)(O)(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21O5P/c1-14(2)18(19)23-17(15-9-5-3-6-10-15)13-24(20,21,22)16-11-7-4-8-12-16/h3-12,17,20-22H,1,13H2,2H3 |
| InChIKey | PBMUTIJMVBTWCF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate?
The IUPAC name of [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate (CID 70145187) is [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate.
What is the SMILES notation for [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate?
The canonical SMILES for [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate is C=C(C)C(=O)OC(CP(O)(O)(O)c1ccccc1)c1ccccc1.
What is the InChIKey of [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate?
The InChIKey is PBMUTIJMVBTWCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21O5P/c1-14(2)18(19)23-17(15-9-5-3-6-10-15)13-24(20,21,22)16-11-7-4-8-12-16/h3-12,17,20-22H,1,13H2,2H3.
What are the key properties of [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate?
[1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate has a molecular weight of 348.34 g/mol, XLogP of 2.45, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-phenyl-2-[trihydroxy(phenyl)-λ5-phosphanyl]ethyl] 2-methylprop-2-enoate is sourced from PubChem (CID 70145187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).