C33H44O4 — CID 70148248
octyl 2-hydroxybenzoate;1,7,7-trimethyl-3-[(4-methylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one (PubChem CID 70148248) has the molecular formula C33H44O4 and a molecular weight of 504.71 g/mol. Its IUPAC name is octyl 2-hydroxybenzoate;1,7,7-trimethyl-3-[(4-methylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one.
| Compound Name | octyl 2-hydroxybenzoate;1,7,7-trimethyl-3-[(4-methylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 70148248 |
| Molecular Formula | C33H44O4 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | octyl 2-hydroxybenzoate;1,7,7-trimethyl-3-[(4-methylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one |
| SMILES | CCCCCCCCOC(=O)c1ccccc1O.Cc1ccc(C=C2C(=O)C3(C)CCC2C3(C)C)cc1 |
| InChI | InChI=1S/C18H22O.C15H22O3/c1-12-5-7-13(8-6-12)11-14-15-9-10-18(4,16(14)19)17(15,2)3;1-2-3-4-5-6-9-12-18-15(17)13-10-7-8-11-14(13)16/h5-8,11,15H,9-10H2,1-4H3;7-8,10-11,16H,2-6,9,12H2,1H3 |
| InChIKey | FFBRNSNCUUHWRD-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|