C12H19N3 — CID 70152908
1,2,3-tris(prop-2-enyl)-2,4-dihydro-1,3,5-triazine (PubChem CID 70152908) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 1,2,3-tris(prop-2-enyl)-2,4-dihydro-1,3,5-triazine.
| Compound Name | 1,2,3-tris(prop-2-enyl)-2,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 70152908 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1,2,3-tris(prop-2-enyl)-2,4-dihydro-1,3,5-triazine |
| SMILES | C=CCC1N(CC=C)C=NCN1CC=C |
| InChI | InChI=1S/C12H19N3/c1-4-7-12-14(8-5-2)10-13-11-15(12)9-6-3/h4-6,10,12H,1-3,7-9,11H2 |
| InChIKey | HRXOZBCRHRPNMO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|