C22H24N2O6 — CID 70154973
(2R)-1-[(2S)-2-amino-2-phenylmethoxycarbonylbutanoyl]-4-methoxy-2,3-dihydroindole-2-carboxylic acid (PubChem CID 70154973) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-amino-2-phenylmethoxycarbonylbutanoyl]-4-methoxy-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2R)-1-[(2S)-2-amino-2-phenylmethoxycarbonylbutanoyl]-4-methoxy-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 70154973 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2R)-1-[(2S)-2-amino-2-phenylmethoxycarbonylbutanoyl]-4-methoxy-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CC[C@@](N)(C(=O)OCc1ccccc1)C(=O)N1c2cccc(OC)c2C[C@@H]1C(=O)O |
| InChI | InChI=1S/C22H24N2O6/c1-3-22(23,21(28)30-13-14-8-5-4-6-9-14)20(27)24-16-10-7-11-18(29-2)15(16)12-17(24)19(25)26/h4-11,17H,3,12-13,23H2,1-2H3,(H,25,26)/t17-,22+/m1/s1 |
| InChIKey | NTVZBQQYUCQNAJ-VGSWGCGISA-N |
| XLogP | 1.89 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|