C15H13NO2S — CID 70155675
(E)-3-phenyl-N-(2-thiophen-2-ylacetyl)prop-2-enamide (PubChem CID 70155675) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is (E)-3-phenyl-N-(2-thiophen-2-ylacetyl)prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-(2-thiophen-2-ylacetyl)prop-2-enamide |
|---|---|
| PubChem CID | 70155675 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (E)-3-phenyl-N-(2-thiophen-2-ylacetyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C15H13NO2S/c17-14(9-8-12-5-2-1-3-6-12)16-15(18)11-13-7-4-10-19-13/h1-10H,11H2,(H,16,17,18)/b9-8+ |
| InChIKey | GMEAPGKJVXRTRO-CMDGGOBGSA-N |
| XLogP | 2.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|