C22H20N2O2S2 — CID 86897702
(E)-3-(4-methylsulfanylphenyl)-N-[2-[(2-thiophen-2-ylacetyl)amino]phenyl]prop-2-enamide (PubChem CID 86897702) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (E)-3-(4-methylsulfanylphenyl)-N-[2-[(2-thiophen-2-ylacetyl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methylsulfanylphenyl)-N-[2-[(2-thiophen-2-ylacetyl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86897702 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (E)-3-(4-methylsulfanylphenyl)-N-[2-[(2-thiophen-2-ylacetyl)amino]phenyl]prop-2-enamide |
| SMILES | CSc1ccc(/C=C/C(=O)Nc2ccccc2NC(=O)Cc2cccs2)cc1 |
| InChI | InChI=1S/C22H20N2O2S2/c1-27-17-11-8-16(9-12-17)10-13-21(25)23-19-6-2-3-7-20(19)24-22(26)15-18-5-4-14-28-18/h2-14H,15H2,1H3,(H,23,25)(H,24,26)/b13-10+ |
| InChIKey | PDJFNQZQNBMJND-JLHYYAGUSA-N |
| XLogP | 5.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|