C19H23N3O2S2 — CID 4091584
3-methyl-N-[(4-methylsulfanylphenyl)methylideneamino]-2-[(2-thiophen-2-ylacetyl)amino]butanamide (PubChem CID 4091584) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 3-methyl-N-[(4-methylsulfanylphenyl)methylideneamino]-2-[(2-thiophen-2-ylacetyl)amino]butanamide.
| Compound Name | 3-methyl-N-[(4-methylsulfanylphenyl)methylideneamino]-2-[(2-thiophen-2-ylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 4091584 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-methyl-N-[(4-methylsulfanylphenyl)methylideneamino]-2-[(2-thiophen-2-ylacetyl)amino]butanamide |
| SMILES | CSc1ccc(C=NNC(=O)C(NC(=O)Cc2cccs2)C(C)C)cc1 |
| InChI | InChI=1S/C19H23N3O2S2/c1-13(2)18(21-17(23)11-16-5-4-10-26-16)19(24)22-20-12-14-6-8-15(25-3)9-7-14/h4-10,12-13,18H,11H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | VDLOQANVIVXJDD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|