C20H25N5O4S — CID 98470912
(2S)-N-[(E)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-3-methyl-2-[(2-thiophen-2-ylacetyl)amino]butanamide (PubChem CID 98470912) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is (2S)-N-[(E)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-3-methyl-2-[(2-thiophen-2-ylacetyl)amino]butanamide.
| Compound Name | (2S)-N-[(E)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-3-methyl-2-[(2-thiophen-2-ylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 98470912 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (2S)-N-[(E)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-3-methyl-2-[(2-thiophen-2-ylacetyl)amino]butanamide |
| SMILES | CC(C)[C@H](NC(=O)Cc1cccs1)C(=O)N/N=C/c1ccc(N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H25N5O4S/c1-13(2)19(22-18(26)11-15-6-5-9-30-15)20(27)23-21-12-14-7-8-16(24(3)4)17(10-14)25(28)29/h5-10,12-13,19H,11H2,1-4H3,(H,22,26)(H,23,27)/b21-12+/t19-/m0/s1 |
| InChIKey | YMAYZKVAAZODFJ-CIPMJJFUSA-N |
| XLogP | 2.56 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|